We offer over 400 N- and C-terminal and internal peptide modifications to help you produce the custom peptides that you need to propel your research forward. This table separates modifications based on type to help you quickly determine which modification will best suit your needs.
Modification types
- Miscellaneous modifications range from biotinylation and carboxymethylation (CAM) to protecting groups such as Fmoc, lysine modifications, and enzyme conjugation
- Fluorescent dyes that include emitting and quenching dyes for fluorescence (or Förster) resonance energy transfer (FRET) and other fluorescence applications
- Linkers, spacers, and polyethylene glycol (PEG) modifications for various labeling applications
- D-stereoisomers, non-natural, and special amino acids
- Post-translational modifications (PTMs) and specific amino acids
- Isotopically labeled (heavy) amino acids and isobaric tags (e.g., TMT™ reagents) for relative and absolute proteomic quantitation
- Carrier proteins to prepare peptide immunogens
- Cyclization, dimerization, and other special synthesis methods
Peptide modification types offered
The table below separates the available modifications by type and provides the name, abbreviations, and location (N- or C-terminal or internal) to help you determine the best modification when ordering custom peptides.
Simply enter text into the search box below, and the table will list only those products that include your text. The table can also be sorted based on any of the column headings.
| Type | Name | Abbreviation or alternative name | Position within sequence | Graphical representation of available positions |
|---|---|---|---|---|
| Misc | 1-Adamantanecarbonyl - | 1-Adamantanecarbonyl-NH | N-term | ■□□□...□□□□ |
| Misc | 2,4,6-Trinitrophenyl - TNP | TNP-NH | N-term | ■□□□...□□□□ |
| Misc | 2-Furoyl - | 2-Furoyl-NH | N-term | ■□□□...□□□□ |
| Misc | 2-Naphtoic acid - | Naphtyl-NH | N-term | ■□□□...□□□□ |
| Misc | 3-(Maleimido)propionyl - | Maleimide-NH | N-term | ■□□□...□□□□ |
| Misc | 3,5-Diiodo-Tyrosine - | [Y(I)2] | Internal | ■■■■...■■■■ |
| Misc | 3-Chloro-Tyrosine - | [Y(Cl)] | Internal | ■■■■...■■■■ |
| Misc | 3-nitro-2-pyridylthio-L-Cys - | [C(Npys)] | Internal | ■■■■...■■■■ |
| Misc | 3-Nitro-Indole - | [3-Nitro-Indole] | Internal | ■■■■...■■■■ |
| Misc | 3-Nitro-Pyrrol - | [3-Nitro-Pyrrol] | Internal | ■■■■...■■■■ |
| Misc | 3-Nitro-Tyrosine - | [Y(NO2)] | Internal | ■■■■...■■■■ |
| Misc | 4-Methylthio-2-oxobutanoic ac. - | [H3C-S-CH2-CH2-CO-CO-NH] | N-term | ■□□□...□□□□ |
| Misc | 4-nitrobenzo-2-oxa-1,3-diazole - NBD | NBD-NH | N-term | ■□□□...□□□□ |
| Misc | 4-Pentynoic acid - | 4-Pentynoic acid-NH | N-term | ■□□□...□□□□ |
| Misc | 4-Phenylazophenol - O-PAP | CO-PAP | C-term | □□□□...□□□■ |
| Misc | 6-Bromo-D/L-Tryptophan - | [D/L-W(Br)] | Internal | ■■■■...■■■■ |
| Misc | 6-Cloro-Tryptophan - | [W(Cl)] | Internal | ■■■■...■■■■ |
| Misc | Acetylation - | Acetyl-NH | N-term | ■□□□...□□□□ |
| Misc | Aldehyde - | CHO | C-term | □□□□...□□□■ |
| Misc | Amidation - | CONH2 | C-term | □□□□...□□□■ |
| Misc | Amino nitrophenyl prop. acid - | [Amino nitrophenyl prop. acid] | Internal | ■■■■...■■■■ |
| Misc | Amino-nitrophenyl propion. ac. - ANP-linker | [ANP] | Internal | ■■■■...■■■■ |
| Misc | Aminooxy acetyl - | H2N-O-CH2-CO-NH | N-term | ■□□□...□□□□ |
| Misc | Benzoyl - Bz | Benzoyl-NH | N-term | ■□□□...□□□□ |
| Misc | Benzyloxy carbonyl - Cbz, Z | Z-NH | N-term | ■□□□...□□□□ |
| Misc | Biotin - | Biotin-NH | N-term | ■□□□...□□□□ |
| Misc | Biotin - Ethylenediamine-Biotin | CO-NH-CH2-CH2-NH-Biotin | C-term | □□□□...□□□■ |
| Misc | Biotin-SS-linker - | Biotin-SS-NH | N-term | ■□□□...□□□□ |
| Misc | Bis(aminoethyl)ethylene glycol - | CO-NH-(CH2-CH2-O)2-CH2-CH2-NH2 | C-term | □□□□...□□□■ |
| Misc | Brom acetic acid - | BrCH2CO-NH | N-term | ■□□□...□□□□ |
| Misc | Chloroethylene - CMK | CMK | C-term | □□□□...□□□■ |
| Misc | Cys(4-Methoxytrityl) - Cys(MMT) | [C(Mmt)] | Internal | ■■■■...■■■■ |
| Misc | Cys(Acetamidomethyl) - Cys(Acm) | [C(Acm)] | Internal | ■■■■...■■■■ |
| Misc | Cys(Carbamidomethyl) - Cys(CAM) / Cys(CH2CONH2) | [C(Cam)] | Internal | ■■■■...■■■■ |
| Misc | Cys(Carboxymethyl) - Cys(CMC) / Cys(CH2COOH) | [C(Cmc)] | Internal | ■■■■...■■■■ |
| Misc | Cys(di(palmitoyloxy)-propyl) - Cys(Pam2) | [C(Pam2)] | Internal | ■■■■...■■■■ |
| Misc | Cys(Farnesyl) - | [C(Farnesyl)] | Internal | ■■■■...■■■■ |
| Misc | Cys(HRP) - Cys(horseradish peroxidase) | [C(HRP)] | Internal | ■■■■...■■■■ |
| Misc | Cys(MTSL) - | [C(MTSL)] | Internal | ■■■■...■■■■ |
| Misc | Cys(Myristyl) - Cys(CH2(CH2)12CH3) | [C(Myristyl)] | Internal | ■■■■...■■■■ |
| Misc | Cys(Palmitoyl) - | [C(Palm)] | Internal | ■■■■...■■■■ |
| Misc | Cys(S-Butyl) - | [C(S-But)] | Internal | ■■■■...■■■■ |
| Misc | Cys(S-Ethyl) - | [C(S-Et)] | Internal | ■■■■...■■■■ |
| Misc | Cys(S-Isobutyl) - | [C(S-Isobut)] | Internal | ■■■■...■■■■ |
| Misc | Cys(S-Isopropyl) - | [C(S-Isoprop)] | Internal | ■■■■...■■■■ |
| Misc | Cys(S-Methyl) - | [C(S-Me)] | Internal | ■■■■...■■■■ |
| Misc | Cys(S-Pentyl) - | [C(S-Pentyl)] | Internal | ■■■■...■■■■ |
| Misc | Cys(S-Propyl) - | [C(S-Prop)] | Internal | ■■■■...■■■■ |
| Misc | Cys(S-tert-Butyl) - | [C(S-tert-But] | Internal | ■■■■...■■■■ |
| Misc | Cysteamide - | Cysteamide | C-term | □□□□...□□□■ |
| Misc | Decanoyl - | Decanoyl-NH | N-term | ■□□□...□□□□ |
| Misc | Desthiobiotin - | Desthiobiotin-NH | N-term | ■□□□...□□□□ |
| Misc | Digoxigenin - | Digoxigenin-NH | N-term | ■□□□...□□□□ |
| Misc | DOTA - | [DOTA] | N-term | ■□□□...□□□□ |
| Misc | Ethylamide - N-Ethyl | CONH(C2H5) | C-term | □□□□...□□□■ |
| Misc | Ethylester - O-Ethyl | COOEt | C-term | □□□□...□□□■ |
| Misc | Fmoc - | Fmoc-NH | N-term | ■□□□...□□□□ |
| Misc | Formyl - | Formyl-NH | N-term | ■□□□...□□□□ |
| Misc | Glu(Arg) - Arg at side chain of Glu | [Glu(Arg)] | Internal | ■■■■...■■■■ |
| Misc | Homoserine lactone - | [Homoser lactone] | C-term | □□□□...□□□■ |
| Misc | HRP - | CO-NH -HRP | C-term | □□□□...□□□■ |
| Misc | HRP - | HRP-NH | N-term | ■□□□...□□□□ |
| Misc | Hydrazide - | CO-NH -NH2 | C-term | □□□□...□□□■ |
| Misc | Hydrazine-succinyl - | H2N-NH-CO-CH2-CH2-CO-NH- | N-term | ■□□□...□□□□ |
| Misc | Iodoacetyl - | IH2C-CO- | N-term | ■□□□...□□□□ |
| Misc | Lys(2-Aminooxy acetic acid) - Lys(Aoa) | [K(Aoa)] | Internal | ■■■■...■■■■ |
| Misc | Lys(Acetyl) - | [K(Ac)] | Internal | ■■■■...■■■■ |
| Misc | Lys(Ahx-Biotin) - | [K(Ahx-Biotin)] | Internal | ■■■■...■■■■ |
| Misc | Lys(Ahx-SS-Biotin) - | [K(Ahx-SS-Biotin)] | Internal | ■■■■...■■■■ |
| Misc | Lys(Biotin) - | [K(Biotin)] | Internal | ■■■■...■■■■ |
| Misc | Lys(Boc) - | [K(Boc)] | Internal | ■■■■...■■■■ |
| Misc | Lys(Butyryl) - | [K(Butyryl)] | Internal | ■■■■...■■■■ |
| Misc | Lys(Desthiobiotin) - | [K(Desthiobiotin)] | Internal | ■■■■...■■■■ |
| Misc | Lys(Digoxigenin] - | [K(Digoxigenin)] | Internal | ■■■■...■■■■ |
| Misc | Lys(DST-PEG 2-Biotin) - | [K(DST-PEG 2-Biotin)] | Internal | ■■■■...■■■■ |
| Misc | Lys(Ferrocene) - | [K(Ferrocene)] | Internal | ■■■■...■■■■ |
| Misc | Lys(Formyl) - | [K(Formyl)] | Internal | ■■■■...■■■■ |
| Misc | Lys(GG) - Ubiquitin | [K(GG)] | Internal | ■■■■...■■■■ |
| Misc | Lys(GGRLR) - | [K(GGRLR)] | Internal | ■■■■...■■■■ |
| Misc | Lys(Glutaryl) - | [K(Glutaryl)] | Internal | ■■■■...■■■■ |
| Misc | Lys(Lipoyl) - | [K(Lipoyl)] | Internal | ■■■■...■■■■ |
| Misc | Lys(NIP) - | [K(NIP)] | Internal | ■■■■...■■■■ |
| Misc | Lys(Palmitoyl) - | [K(Palmitoyl)] | Internal | ■■■■...■■■■ |
| Misc | Lys(Propionyl) - | [K(Propionyl)] | Internal | ■■■■...■■■■ |
| Misc | Lys(Pyrofolate) - | [K(Pyrofolate)] | Internal | ■■■■...■■■■ |
| Misc | Lys(Stearyl) - | [K(Stearyl)] | Internal | ■■■■...■■■■ |
| Misc | Lys(Succinyl) - | [K(Succinyl)] | Internal | ■■■■...■■■■ |
| Misc | Lys(TFA) - Lysine(Trifluoroacetyl) | [K(TFA)] | Internal | ■■■■...■■■■ |
| Misc | Maleimide - via SMCC | Maleimide-NH | N-term | ■□□□...□□□□ |
| Misc | Methanethiosulfonate - MTS | MTS-NH | N-term | ■□□□...□□□□ |
| Misc | Methoxysuccinyl - | H3C-O-CO-CH2-CH2-CO-NH | N-term | ■□□□...□□□□ |
| Misc | Methylamide - N-Methyl | CO-NH(CH3) | C-term | □□□□...□□□■ |
| Misc | Methylester - O-Methyl | COOMe | C-term | □□□□...□□□■ |
| Misc | Myristoyl - | Myristoyl-NH | N-term | ■□□□...□□□□ |
| Misc | N-Hydroxysuccinimid ester - NHS | CO-NHS | C-term | □□□□...□□□■ |
| Misc | Orn(Biotin) - | [Orn(Biotin)] | Internal | ■■■■...■■■■ |
| Misc | Palmitoyl - | Palmitoyl-NH | N-term | ■□□□...□□□□ |
| Misc | para-Bromo-D-Phenylalanine - | [D-F(4-Br)] | Internal | ■■■■...■■■■ |
| Misc | para-Chloro-Phenylalanine - | [F(4-Cl)] | Internal | ■■■■...■■■■ |
| Misc | para-Iodo-Phenylalanine - | [F(I)] | Internal | ■■■■...■■■■ |
| Misc | para-Nitro-Phenylalanine - | [F(NO2)] | Internal | ■■■■...■■■■ |
| Misc | Phenylacetic acid - Paa | Paa-NH | N-term | ■□□□...□□□□ |
| Misc | Photo-Leucine - | [Photo-L] | Internal | ■■■■...■■■■ |
| Misc | Photo-Methionine - | [Photo-M] | Internal | ■■■■...■■■■ |
| Misc | p-tosyl-Gly - | [p-tosyl-G] | N-term | ■□□□...□□□□ |
| Misc | S-Acetylmercaptosuccinyl - SAMSA | SAMSA-NH | N-term | ■□□□...□□□□ |
| Misc | Ser(Acetyl) - | [S(Ac)] | Internal | ■■■■...■■■■ |
| Misc | Ser(Octanoyl) - | [S(Oct)] | Internal | ■■■■...■■■■ |
| Misc | Stearyl - | Stearyl-NH | N-term | ■□□□...□□□□ |
| Misc | Succinyl - | Succinyl-NH | N-term | ■□□□...□□□□ |
| Misc | t-Butylester - | COOtBu | C-term | □□□□...□□□■ |
| Misc | tert. Butoxycarbonyl - Boc | Boc-NH | N-term | ■□□□...□□□□ |
| Misc | Thiobenzyl - | CO-S(Bzl) | C-term | □□□□...□□□■ |
| Misc | Thiopropionyl - Tpa | Tpa-NH | N-term | ■□□□...□□□□ |
| Misc | trans-Cinnamoyl - | Cinnamoyl-NH | N-term | ■□□□...□□□□ |
| Misc | Tyr(Palmitoyl) - | [Y(Palm)] | Internal | ■■■■...■■■■ |
| Dye | (2,4-Dinitrophenyl)-Glycine - (2,4-DNP)-Gly | DNP-NH-G | N-term | ■□□□...□□□□ |
| Dye | 2,4-Dinitrophenyl - DNP | CO-DNP | C-term | □□□□...□□□■ |
| Dye | 2,4-Dinitrophenyl - DNP | DNP-NH | N-term | ■□□□...□□□□ |
| Dye | 5/6-Carboxyfluorescein - 5/6-FLUO | 5/6-Fluorescein-NH | N-term | ■□□□...□□□□ |
| Dye | 5/6-Tetramethylrhodamine - 5/6-TAMRA | 5/6-TAMRA-NH | N-term | ■□□□...□□□□ |
| Dye | 5-Carboxyfluorescein - 5-FLUO | 5-Fluorescein-NH | N-term | ■□□□...□□□□ |
| Dye | 5-Tetramethylrhodamine - 5-TAMRA | 5-TAMRA-NH | N-term | ■□□□...□□□□ |
| Dye | 6-Carboxyfluorescein - 6-FLUO | 6-Fluorescein-NH | N-term | ■□□□...□□□□ |
| Dye | 6-Tetramethylrhodamine - 6-TAMRA | 6-TAMRA-NH | N-term | ■□□□...□□□□ |
| Dye | 7-Amino-4-methylcoumarin - AMC | CO-AMC | C-term | □□□□...□□□■ |
| Dye | Ala(2-Bacd) - benzo[b]acridin-12(5H)-on-2-yl | [Ala(2-Bacd)] | Internal | ■■■■...■■■■ |
| Dye | Amino-trifluoromethyl-coumarin - AFC | CO-AFC | C-term | □□□□...□□□■ |
| Dye | ATTO 647N - | ATTO 647N-NH | N-term | ■□□□...□□□□ |
| Dye | Cy7 - | Cy7-NH | N-term | ■□□□...□□□□ |
| Dye | Cys(5/6-TAMRA) - | [C(5/6-TAMRA)] | Internal | ■■■■...■■■■ |
| Dye | Cys(5-TAMRA) - | [C(5-TAMRA)] | Internal | ■■■■...■■■■ |
| Dye | Cys(6-TAMRA) - | [C(6-TAMRA)] | Internal | ■■■■...■■■■ |
| Dye | Cys(acetamido-fluorescein) - | [C(acetamido-fluorescein)] | Internal | ■■■■...■■■■ |
| Dye | Cys(AEDANS) - | [C(AEDANS)] | Internal | ■■■■...■■■■ |
| Dye | Cys(Allophycocyanine) - | [C(Allophycocyanine)] | Internal | ■■■■...■■■■ |
| Dye | Cys(DY 555) - | [C(DY 555)] | Internal | ■■■■...■■■■ |
| Dye | Cys(DY 647P1) - | [C(DY 647P1)] | Internal | ■■■■...■■■■ |
| Dye | Cys(DY 649) - | [C(DY 649)] | Internal | ■■■■...■■■■ |
| Dye | Cys(DYQ660) - | [Cys(DYQ660)] | Internal | ■■■■...■■■■ |
| Dye | Dabcyl - | Dabcyl-NH | N-term | ■□□□...□□□□ |
| Dye | Dabsyl - | Dabsyl-NH | N-term | ■□□□...□□□□ |
| Dye | Dansyl - | CO-Dansyl | C-term | □□□□...□□□■ |
| Dye | Dansyl - | Dansyl-NH | N-term | ■□□□...□□□□ |
| Dye | DAP(DNP) - DNP at Diaminopropionic acid | [DAP(DNP)] | Internal | ■■■■...■■■■ |
| Dye | DAP(DY 647) - DY 647 at Diaminopropionic ac. | [DPA(DY-647)] | Internal | ■■■■...■■■■ |
| Dye | DAP(DyLight 488) - DyLight 488 at Diaminoprop. ac | [DPA(DY 488)] | Internal | ■■■■...■■■■ |
| Dye | DAP(NMA) - NMA at Diaminopropionic acid | [DAP(NMA)] | Internal | ■■■■...■■■■ |
| Dye | Dinitrophenyl-Ethylenediamine - EDDnp | CO-EDDnp | C-term | □□□□...□□□■ |
| Dye | D-Lys(5/6-Fluorescein) - | [D-K(5/6-Fluorescein)] | Internal | ■■■■...■■■■ |
| Dye | D-Lys(5/6-TAMRA) - | [D-Lys(5/6-TAMRA)] | Internal | ■■■■...■■■■ |
| Dye | DY 495 - | DY 495-NH | N-term | ■□□□...□□□□ |
| Dye | DY 505 - | DY 505-NH | N-term | ■□□□...□□□□ |
| Dye | DY 530 - | DY 530-NH | N-term | ■□□□...□□□□ |
| Dye | DY 547 - | DY 547-NH | N-term | ■□□□...□□□□ |
| Dye | DY 549 - | DY 549-NH | N-term | ■□□□...□□□□ |
| Dye | DY 630 - | DY630-NH | N-term | ■□□□...□□□□ |
| Dye | DY 633 - | DY 633-NH | N-term | ■□□□...□□□□ |
| Dye | DY 635 - | DY 635-NH | N-term | ■□□□...□□□□ |
| Dye | DY 647 - | DY 647-NH | N-term | ■□□□...□□□□ |
| Dye | DY 647 - aminomodified | CO-DY 647 | C-term | □□□□...□□□■ |
| Dye | DY 649 - | DY 649-NH | N-term | ■□□□...□□□□ |
| Dye | DY 649P1 - aminomodified | CO-DY 649P1 | N-term | ■□□□...□□□□ |
| Dye | DY 650 - | DY650-NH | Internal | ■■■■...■■■■ |
| Dye | DY 680 - | DY 680-NH | N-term | ■□□□...□□□□ |
| Dye | DY 682 - | DY 682-NH | N-term | ■□□□...□□□□ |
| Dye | DY 750 - | DY 750-NH | N-term | ■□□□...□□□□ |
| Dye | DY 750 - | CO-DY 750 | C-term | □□□□...□□□■ |
| Dye | DY 751 - | DY 751-NH | N-term | ■□□□...□□□□ |
| Dye | DY 800 - | DY 800-NH | N-term | ■□□□...□□□□ |
| Dye | DyLight 488 - | DY 488-NH | N-term | ■□□□...□□□□ |
| Dye | DyLight 504Q - | DyLight 504Q-NH | N-term | ■□□□...□□□□ |
| Dye | DyLight 543Q - | DyLight 543Q-NH | N-term | ■□□□...□□□□ |
| Dye | DyLight 554-R1 - | DyLight 554-R1-NH | N-term | ■□□□...□□□□ |
| Dye | DyLight 683Q - | DyLight 683Q-NH | N-term | ■□□□...□□□□ |
| Dye | DYQ 660 - | DYQ 660-NH | N-term | ■□□□...□□□□ |
| Dye | EDANS - | CO-EDANS | C-term | □□□□...□□□■ |
| Dye | Glu(EDANS) - | [E(EDANS)] | Internal | ■■■■...■■■■ |
| Dye | His(DNP) - | [H(DNP)] | Internal | ■■■■...■■■■ |
| Dye | Lys(2-(N-methylamino)benzoyl) - Lys(NMA) | [Lys(NMA)] | Internal | ■■■■...■■■■ |
| Dye | Lys(2,4-DNP) - | [K(DNP)] | Internal | ■■■■...■■■■ |
| Dye | Lys(5/6-Fluorescein) - | [K(5/6-Fluo)] | Internal | ■■■■...■■■■ |
| Dye | Lys(5/6-TAMRA) - | [K(5/6-TAMRA)] | Internal | ■■■■...■■■■ |
| Dye | Lys(5-Fluorescein) - | [K(5-Fluo)] | Internal | ■■■■...■■■■ |
| Dye | Lys(5-TAMRA) - | [K(5-TAMRA)] | Internal | ■■■■...■■■■ |
| Dye | Lys(6-Fluorescein) - | [K(6-Fluo)] | Internal | ■■■■...■■■■ |
| Dye | Lys(Ahx-(5-Fluorescein)) - | [K(Ahx-(5-Fluo))] | Internal | ■■■■...■■■■ |
| Dye | Lys(ATTO 655) - | [K(ATTO 655)] | Internal | ■■■■...■■■■ |
| Dye | Lys(Dabcyl) - | [K(Dabcyl)] | Internal | ■■■■...■■■■ |
| Dye | Lys(Dde) - | [Lys(Dde)] | Internal | ■■■■...■■■■ |
| Dye | Lys(DY 405) - | [K(DY 405)] | Internal | ■■■■...■■■■ |
| Dye | Lys(DY 495) - | [K(DY 495)] | Internal | ■■■■...■■■■ |
| Dye | Lys(DY 530) - | [K(DY 530)] | Internal | ■■■■...■■■■ |
| Dye | Lys(DY 547) - | [K(DY 547)] | Internal | ■■■■...■■■■ |
| Dye | Lys(DY 590) - | [K(DY 590)] | Internal | ■■■■...■■■■ |
| Dye | Lys(DY 630) - | [K(DY 630)] | Internal | ■■■■...■■■■ |
| Dye | Lys(DY 635) - | [K(DY 635)] | Internal | ■■■■...■■■■ |
| Dye | Lys(DY 647) - | [K(DY 647)] | Internal | ■■■■...■■■■ |
| Dye | Lys(DY 650) - | [Lys(DY 650)] | Internal | ■■■■...■■■■ |
| Dye | Lys(DY 800) - | [K(DY 800)] | Internal | ■■■■...■■■■ |
| Dye | Lys(DyLight 488) - | [K(DY 488)] | Internal | ■■■■...■■■■ |
| Dye | Lys(DyLight 633) - Lys(DY633) | [K(DyLight 633)] | Internal | ■■■■...■■■■ |
| Dye | Lys(DyLight 649) - | [K(DY 649)] | Internal | ■■■■...■■■■ |
| Dye | Lys(DYQ 3) - | [K(DYQ 3)] | Internal | ■■■■...■■■■ |
| Dye | Lys(HOC) - (7-hydroxycoumarin-3-yl)formyl | [Lys(HOC)] | Internal | ■■■■...■■■■ |
| Dye | Lys(HOMCA) - | [Lys(HOMCA)] | Internal | ■■■■...■■■■ |
| Dye | Lys(MCA) - | [K(MCA)] | Internal | ■■■■...■■■■ |
| Dye | Lys(MOC) - (7-methoxycoumarin-3-yl)formyl | Lys(MOC) | Internal | ■■■■...■■■■ |
| Dye | Lys(Rhodamine B) - | [K(Rhodamine B)] | Internal | ■■■■...■■■■ |
| Dye | Lys(Rhodamine Green) - | [K(Rhodamine Green)] | Internal | ■■■■...■■■■ |
| Dye | Methoxycoumarin acetic acid - MCA | CO-MCA | C-term | □□□□...□□□■ |
| Dye | Methoxycoumarin acetic acid - MCA | MCA-NH | N-term | ■□□□...□□□□ |
| Dye | Ornithine(Coumarin343) - | [Orn(C343)] | Internal | ■■■■...■■■■ |
| Dye | para-Nitroanilide - pNA | CO-pNA | C-term | □□□□...□□□■ |
| Dye | para-Nitrophenylester - | COONp | C-term | □□□□...□□□■ |
| Dye | QSY21 - | QSY21-NH | N-term | ■□□□...□□□□ |
| Dye | Rhodamine 110 - | CO-Rhod 110 | C-term | □□□□...□□□■ |
| Dye | Rhodamine B - | Rhodamin B-NH | N-term | ■□□□...□□□□ |
| Dye | R-Phycoerythrin - | CO- R-Phycoerythrin | C-term | □□□□...□□□■ |
| Dye | Tide Quencher 2 - TQ2 | TQ2-NH | N-term | ■□□□...□□□□ |
| Linkers | 12-Aminododecanoic acid - Ado | [Ado] | Internal | ■■■■...■■■■ |
| Linkers | 5-Aminopentanoic acid - Aminovaleric acid (Ava) | [Ava] | Internal | ■■■■...■■■■ |
| Linkers | 6-Aminohexanoic acid (Ahx) - Aminocaproic acid (Aca) | [Ahx] | Internal | ■■■■...■■■■ |
| Linkers | 8-Aminooctanoic acid - Aoc | [Aoc] | Internal | ■■■■...■■■■ |
| Linkers | Cys(PEG 40000) - | [C(PEG 40000)] | Internal | ■■■■...■■■■ |
| Linkers | Methyl-PEG12 - MS(PEG)12 | MS(PEG)12-NH | N-term | ■□□□...□□□□ |
| Linkers | Methyl-PEG24 - MS(PEG)24 | MS(PEG)24-NH | N-term | ■□□□...□□□□ |
| Linkers | PEG 12 (40 atoms) - Amino-PEG-acid | [PEG 12] | Internal | ■■■■...■■■■ |
| Linkers | PEG 2 (9 atoms) - 8-Amino-3,6-dioxaoctanoic acid | [PEG 2] | Internal | ■■■■...■■■■ |
| Linkers | PEG 20,000 - | PEG 20,000-NH | N-term | ■□□□...□□□□ |
| Linkers | PEG 2000 - Amino-PEG-acid | [PEG 2000] | Internal | ■■■■...■■■■ |
| Linkers | PEG 3 (13 atoms) - Amino-trioxadodecanoic acid | [PEG 3] | Internal | ■■■■...■■■■ |
| Linkers | PEG 4 (16 atoms) - Amino-PEG-acid | [PEG 4] | Internal | ■■■■...■■■■ |
| Linkers | PEG 5 (19 atoms) - Amino-PEG-acid | [PEG 5] | Internal | ■■■■...■■■■ |
| Linkers | PEG 5000 - | CO-PEG 5000 | C-term | □□□□...□□□■ |
| Linkers | PEG 5000 - Amino-PEG-acid | [PEG 5000] | Internal | ■■■■...■■■■ |
| Linkers | PEG 6 (22 atoms) - Amino-PEG-acid | [PEG 6] | Internal | ■■■■...■■■■ |
| Linkers | PEG 8 (28 atoms) - Amino-PEG-acid | [PEG 8] | Internal | ■■■■...■■■■ |
| Linkers | PEG-4 Azide - | N3-PEG4-NH | N-term | ■□□□...□□□□ |
| Special AAs | 2-(4'-Pentenyl)alanine - | [A(pentenyl)] | Internal | ■■■■...■■■■ |
| Special AAs | 2,3-Diaminopropionic acid - DAP | [DAP] | Internal | ■■■■...■■■■ |
| Special AAs | 2-Amino-4-thiazolinic acid - | [2-Amino-4-thiazolinyl] | Internal | ■■■■...■■■■ |
| Special AAs | 2-Indanyl-Glycine - Igl | [Igl] | Internal | ■■■■...■■■■ |
| Special AAs | 2-Methyl-D-Tryptophan - | [D-W(2-Me)] | Internal | ■■■■...■■■■ |
| Special AAs | 2-Naphthyl-Alanine - 2-Nal | [2-Nal] | Internal | ■■■■...■■■■ |
| Special AAs | 2-Naphthyl-D-Alanine - D-2-Nal | [D-2-Nal] | Internal | ■■■■...■■■■ |
| Special AAs | 3,3-Diphenyl-Alanine - | [A(F2)] | Internal | ■■■■...■■■■ |
| Special AAs | 3,4-Dihydroxy-Phenylalanine - | [F(OH)2] | Internal | ■■■■...■■■■ |
| Special AAs | 5,5-Dimethyl-Proline - | [P(Me2)] | Internal | ■■■■...■■■■ |
| Special AAs | 5-Hydroxy-Tryptophan - | [W(OH)] | Internal | ■■■■...■■■■ |
| Special AAs | Allyl-Glycine - 2-Aminopent-4-enoic acid | [G(allyl)] | Internal | ■■■■...■■■■ |
| Special AAs | alpha-Allylalanine - | [Allyl-A] | Internal | ■■■■...■■■■ |
| Special AAs | alpha-aminoadipic acid - Aad | [Aad] | Internal | ■■■■...■■■■ |
| Special AAs | alpha-t-butylglycine - | [G(tBu)] | Internal | ■■■■...■■■■ |
| Special AAs | Aminobenzoic acid - Abz | [Abz] | Internal | ■■■■...■■■■ |
| Special AAs | Aminobutyric acid - Abu | [Abu] | Internal | ■■■■...■■■■ |
| Special AAs | Aminocyclohexyl carbox. acid - Ac6c | [Ac6c] | Internal | ■■■■...■■■■ |
| Special AAs | Aminoisobutyric acid - Aib | 0 | Internal | ■■■■...■■■■ |
| Special AAs | Asp beta-methyl ester - Asp(OMe) | [D(OMe)] | Internal | ■■■■...■■■■ |
| Special AAs | Asp(Isopropylamide) - | [D(Isopropylamide)] | Internal | ■■■■...■■■■ |
| Special AAs | Azetidine-2-carboxylic acid - Aze | [Aze] | Internal | ■■■■...■■■■ |
| Special AAs | Canavanine - Cav | [Cav] | Internal | ■■■■...■■■■ |
| Special AAs | Citrulline - | [Cit] | Internal | ■■■■...■■■■ |
| Special AAs | Cyclopentyl-Glycine - | [G(cyclopentyl)] | Internal | ■■■■...■■■■ |
| Special AAs | Cysteic acid - Cya | [Cya] | Internal | ■■■■...■■■■ |
| Special AAs | Cysteine sulfonate - | [C(SO3H)] | Internal | ■■■■...■■■■ |
| Special AAs | D-2-Indanyl-Glycine - D-Igl | [D-Igl] | Internal | ■■■■...■■■■ |
| Special AAs | D-4-Hydroxyphenly-Glycine - D-Hpg | [D-Hpg] | Internal | ■■■■...■■■■ |
| Special AAs | D-Alanine - | *A | Internal | ■■■■...■■■■ |
| Special AAs | D-Amino Acid - | [D-aa] | Internal | ■■■■...■■■■ |
| Special AAs | D-Arginine - | *R | Internal | ■■■■...■■■■ |
| Special AAs | D-Asparagine - | *N | Internal | ■■■■...■■■■ |
| Special AAs | D-Aspartic acid - | *D | Internal | ■■■■...■■■■ |
| Special AAs | D-Cysteine - | *C | Internal | ■■■■...■■■■ |
| Special AAs | D-Glutamic acid - | *E | Internal | ■■■■...■■■■ |
| Special AAs | D-Glutamine - | *Q | Internal | ■■■■...■■■■ |
| Special AAs | D-Histidine - | *H | Internal | ■■■■...■■■■ |
| Special AAs | D-Homocysteine - | [D-Homocys] | Internal | ■■■■...■■■■ |
| Special AAs | D-Homoserine - | [D-Homoser] | Internal | ■■■■...■■■■ |
| Special AAs | Diaminotrioxatridecan suc. ac. - TTDS | [TTDS] | Internal | ■■■■...■■■■ |
| Special AAs | D-Isoleucine - | *I | Internal | ■■■■...■■■■ |
| Special AAs | D-Leucine - | *L | Internal | ■■■■...■■■■ |
| Special AAs | D-Lysine - | *K | Internal | ■■■■...■■■■ |
| Special AAs | D-Methionine - | *M | Internal | ■■■■...■■■■ |
| Special AAs | D-Ornithine - | [D-Orn] | Internal | ■■■■...■■■■ |
| Special AAs | D-Phenylalanine - | *F | Internal | ■■■■...■■■■ |
| Special AAs | D-Proline - | *P | Internal | ■■■■...■■■■ |
| Special AAs | D-Serine - | *S | Internal | ■■■■...■■■■ |
| Special AAs | D-Threonine - | *T | Internal | ■■■■...■■■■ |
| Special AAs | D-Tryptophan - | *W | Internal | ■■■■...■■■■ |
| Special AAs | D-Tyrosine - | *Y | Internal | ■■■■...■■■■ |
| Special AAs | D-Valine - | *V | Internal | ■■■■...■■■■ |
| Special AAs | Formylglycine - | [G(CHO)] | Internal | ■■■■...■■■■ |
| Special AAs | gamma-Carboxyglutamic acid - Gla | [Gla] | Internal | ■■■■...■■■■ |
| Special AAs | Gamma-Glu, amidated - Gla, amidation at side chain | [Gla amide] | Internal | ■■■■...■■■■ |
| Special AAs | Glu gamma-methyl ester - Glu(OMe) | [E(OMe)] | Internal | ■■■■...■■■■ |
| Special AAs | Homo-Citrulline - | [Homocit] | Internal | ■■■■...■■■■ |
| Special AAs | Homophenylalanine - | [HomoF] | Internal | ■■■■...■■■■ |
| Special AAs | Homoserine - | [Homoser] | Internal | ■■■■...■■■■ |
| Special AAs | Hydroxy-Proline - Hyp | [Hyp] | Internal | ■■■■...■■■■ |
| Special AAs | Hyposine - Hpu | [Hpu] | Internal | ■■■■...■■■■ |
| Special AAs | Isoaspartic acid - | 0 | Internal | ■■■■...■■■■ |
| Special AAs | Kynurenine - Kyn | [Kyn] | Internal | ■■■■...■■■■ |
| Special AAs | Mercaptoacetic acid - Thioglycolic acid | [Mercaptoacetyl] | Internal | ■■■■...■■■■ |
| Special AAs | Mercaptopropionic acid - Mpa | [Mpa] | Internal | ■■■■...■■■■ |
| Special AAs | Methionine-sulfone - | [M(O2)] | Internal | ■■■■...■■■■ |
| Special AAs | Methionine-sulfoxide - | [M(O)] | Internal | ■■■■...■■■■ |
| Special AAs | N-Formylkynurenine - | [Formyl-Kyn] | Internal | ■■■■...■■■■ |
| Special AAs | Norleucine - | [Nle] | Internal | ■■■■...■■■■ |
| Special AAs | Norvaline - 2-Aminopentanoic acid, Nva | [Nva] | Internal | ■■■■...■■■■ |
| Special AAs | Octahydroindole carbox. acid - | [Oic] | Internal | ■■■■...■■■■ |
| Special AAs | Ornitine - | [Orn] | Internal | ■■■■...■■■■ |
| Special AAs | para-Acetylphenylalanine - pAF | [para-Ac-Phe] | Internal | ■■■■...■■■■ |
| Special AAs | Phenylglycine - Phg | [Phg] | Internal | ■■■■...■■■■ |
| Special AAs | Pyroglutamic acid - Pyr | [Pyr] | Internal | ■■■■...■■■■ |
| Special AAs | Selenocysteine - Sec | [Sec] | Internal | ■■■■...■■■■ |
| Special AAs | β-Alanine - | [β-A] | Internal | ■■■■...■■■■ |
| Special AAs | β-Cyclohexyl-Alanine - Cha | [Cha] | Internal | ■■■■...■■■■ |
| Special AAs | β-cyclohexyl-D-Alanine - D-Cha | [D-Cha] | Internal | ■■■■...■■■■ |
| Special AAs | Tetrahydroisquinol.carb.acid - Tic | [Tic] | Internal | ■■■■...■■■■ |
| Special AAs | Thiazolidine-4-carboxylic acid - Thz | [Thz] | Internal | ■■■■...■■■■ |
| Special AAs | γ-Glutamic acid - | [γ-E] | Internal | ■■■■...■■■■ |
| PTM | 1-Methyl-Tryptophan - | [W(1-Me)] | Internal | ■■■■...■■■■ |
| PTM | 2,6-Dimethyl-Tyrosine - | [Y(Me2)] | Internal | ■■■■...■■■■ |
| PTM | 2-Methylproline - | [P(2-Me)] | Internal | ■■■■...■■■■ |
| PTM | 2-Methyl-Tryptophan - | [2-Me-Trp] | Internal | ■■■■...■■■■ |
| PTM | Dimethyl-Arginine (asym.) - | [R(Me)2-asym] | Internal | ■■■■...■■■■ |
| PTM | Dimethyl-Arginine (sym.) - | [R(Me)2-sym] | Internal | ■■■■...■■■■ |
| PTM | Dimethyl-Cysteine - Penicillamine | [Pen] | Internal | ■■■■...■■■■ |
| PTM | Dimethyl-Lysine - | [K(Me)2] | Internal | ■■■■...■■■■ |
| PTM | Dimethyl-Phenylalanine - | [F(Me)2] | Internal | ■■■■...■■■■ |
| PTM | Dimethyl-Valine - | [V(Me)2] | Internal | ■■■■...■■■■ |
| PTM | Methyl-Arginine - | [R(Me)] | Internal | ■■■■...■■■■ |
| PTM | Methyl-Lysine - | [K(Me)] | Internal | ■■■■...■■■■ |
| PTM | N-Methyl-Alanine - | [Ala(N-Me)] | Internal | ■■■■...■■■■ |
| PTM | N-Methyl-Glycine - | [G(N-Me)] | Internal | ■■■■...■■■■ |
| PTM | N-Methyl-Leucine - | [L(N-Me)] | Internal | ■■■■...■■■■ |
| PTM | N-Methyl-Phenylalanine - | [F(N-Me)] | Internal | ■■■■...■■■■ |
| PTM | N-Methyl-Tyrosine - | [Y(N-Me)] | Internal | ■■■■...■■■■ |
| PTM | N-Methyl-Valine - | [V(N-Me)] | Internal | ■■■■...■■■■ |
| PTM | Phosphono-Phenylalanine - | [F(PO3H2)] | Internal | ■■■■...■■■■ |
| PTM | Phospho-Serine - | [S(PO3H2)] | Internal | ■■■■...■■■■ |
| PTM | Phospho-Threonin - | [T(PO3H2)] | Internal | ■■■■...■■■■ |
| PTM | Phospho-Tyrosin - | [Y(PO3H2)] | Internal | ■■■■...■■■■ |
| PTM | β-GalNAc-Threonine - | [T(β-GalNAc)] | Internal | ■■■■...■■■■ |
| PTM | β-GlcNAc-Asparagine - | [N(β-GlcNAc)] | Internal | ■■■■...■■■■ |
| PTM | β-GlcNAc-Serine - | [S(β-GlcNAc)] | Internal | ■■■■...■■■■ |
| PTM | β-GlcNAc-Threonine - | [T(β-GlcNAc)] | Internal | ■■■■...■■■■ |
| PTM | Sulfuryl-Serine - | [S(SO3H)] | Internal | ■■■■...■■■■ |
| PTM | Sulfuryl-Threonine - | [T(SO3H)] | Internal | ■■■■...■■■■ |
| PTM | Sulfuryl-Tyrosine - | [Y(SO3H)] | Internal | ■■■■...■■■■ |
| PTM | Trimethyl-Arginine - | [R(Me3)] | Internal | ■■■■...■■■■ |
| PTM | Trimethyl-Lysine - | [K(Me)3] | Internal | ■■■■...■■■■ |
| PTM | α-GalNAc-Serine - | [S(α-GalNAc)] | Internal | ■■■■...■■■■ |
| PTM | α-GalNAc-Threonine - | [T(α-GalNAc)] | Internal | ■■■■...■■■■ |
| PTM | α-Mannosyl-Serine - | [S(α-Mannosyl)] | Internal | ■■■■...■■■■ |
| PTM | α-Mannosyl-Threonine - | [T(α-Mannosyl)] | Internal | ■■■■...■■■■ |
| PTM | α-Methyl Aspartic acid - | [D(α-Me)] | Internal | ■■■■...■■■■ |
| PTM | α-Methyl Glutamic acid - | [E(α-Me)] | Internal | ■■■■...■■■■ |
| Isotopic | Heavy Ala (13C3;15N) - | [A(13C3; 15N)] | Internal | ■■■■...■■■■ |
| Isotopic | Heavy Ala (D3) - | [A(D3)] | Internal | ■■■■...■■■■ |
| Isotopic | Heavy Arg (13C6) - | [R(13C6)] | Internal | ■■■■...■■■■ |
| Isotopic | Heavy Arg (13C6;15N4) - | [R(13C6; 15N4)] | Internal | ■■■■...■■■■ |
| Isotopic | Heavy Asn (13C4;15N2) - | [N(13C4; 15N2)] | Internal | ■■■■...■■■■ |
| Isotopic | Heavy Asp (13C4;15N - | [D(13C4; 15N)] | Internal | ■■■■...■■■■ |
| Isotopic | Heavy Gln (13C5;15N2) - | [Q(13C5;15N2)] | Internal | ■■■■...■■■■ |
| Isotopic | Heavy Glu (13C5;15N) - | [E(13C5; 15N)] | Internal | ■■■■...■■■■ |
| Isotopic | Heavy Gly (13C2;15N) - | [G(13C2; 15N)] | Internal | ■■■■...■■■■ |
| Isotopic | Heavy His (15N3) - | [His(15N3)] | Internal | ■■■■...■■■■ |
| Isotopic | Heavy Ile (13C6;15N) - | [I(13C6; 15N)] | Internal | ■■■■...■■■■ |
| Isotopic | Heavy Leu (13C1) - | [L(13C1)] | Internal | ■■■■...■■■■ |
| Isotopic | Heavy Leu (13C6) - | [L(13C6)] | Internal | ■■■■...■■■■ |
| Isotopic | Heavy Leu (13C6;15N) - | [L(13C6; 15N)] | Internal | ■■■■...■■■■ |
| Isotopic | Heavy Leu (D10) - | [L(D10)] | Internal | ■■■■...■■■■ |
| Isotopic | Heavy Leu (D3) - | [L(D3)] | Internal | ■■■■...■■■■ |
| Isotopic | Heavy Lys (13C6) - | [K(13C6)] | Internal | ■■■■...■■■■ |
| Isotopic | Heavy Lys (13C6;15N2) - | [K(13C6; 15N2)] | Internal | ■■■■...■■■■ |
| Isotopic | Heavy Phe (13C9;15N) - | [F(13C9; 15N)] | Internal | ■■■■...■■■■ |
| Isotopic | Heavy Pro (13C5;15N) - | [P(13C5; 15N)] | Internal | ■■■■...■■■■ |
| Isotopic | Heavy Ser (13C3;15N) - | [S (13C3;15N)] | Internal | ■■■■...■■■■ |
| Isotopic | Heavy Ser (D3) - | [S(D3)] | Internal | ■■■■...■■■■ |
| Isotopic | Heavy Thr(13C4;15N) - | [T(13C4;15N)] | Internal | ■■■■...■■■■ |
| Isotopic | Heavy Trp (13C11;15N2) - | [W (13C11;15N2)] | Internal | ■■■■...■■■■ |
| Isotopic | Heavy Tyr (13C9;15N) - | [Y (13C9; 15N)] | Internal | ■■■■...■■■■ |
| Isotopic | Heavy Val (13C5) - | [V(13C5)] | Internal | ■■■■...■■■■ |
| Isotopic | Heavy Val (13C5;15N) - | [V(13C5; 15N)] | Internal | ■■■■...■■■■ |
| Isotopic | L-tyrosine-phenyl-d4 - deuterated Tyr | [Tyr(D4)] | Internal | ■■■■...■■■■ |
| Isotopic | TMT6-126 - | TMT6-126-NH | N-term | ■□□□...□□□□ |
| Isotopic | TMT6-127 - | TMT6-127-NH | N-term | ■□□□...□□□□ |
| Isotopic | TMT6-128 - | TMT6-128-NH | N-term | ■□□□...□□□□ |
| Isotopic | TMT6-129 - | TMT6-129-NH | N-term | ■□□□...□□□□ |
| Isotopic | TMT6-130 - | TMT6-130-NH | N-term | ■□□□...□□□□ |
| Isotopic | TMT6-131 - | TMT6-131-NH | N-term | ■□□□...□□□□ |
| Immunization | Blue Carrier Protein - | CO-NH -Blue Carrier Protein | C-term | □□□□...□□□■ |
| Immunization | BSA - | CO-BSA | C-term | □□□□...□□□■ |
| Immunization | BSA via Glutaraldehyde - | BSA-NH | N-term | ■□□□...□□□□ |
| Immunization | Cys(BSA) - | [C(BSA)] | Internal | ■■■■...■■■■ |
| Immunization | Cys(KLH) - | [C(KLH)] | Internal | ■■■■...■■■■ |
| Immunization | Cys(OVA) - | [C(OVA)] | Internal | ■■■■...■■■■ |
| Immunization | KLH - | CO-KLH | C-term | □□□□...□□□■ |
| Immunization | KLH via Glutaraldehyde - | KLH-NH | N-term | ■□□□...□□□□ |
| Immunization | Lys(BSA) - | [K(BSA] | Internal | ■■■■...■■■■ |
| Immunization | Lys(KLH) - | [K(KLH] | Internal | ■■■■...■■■■ |
| Immunization | MAP 16 - Crude 8-20 aa, at C-term. only | MAP 16 | C-term | □□□□...□□□■ |
| Immunization | MAP 4 - Crude 8-20 aa, at C-term. only | MAP 4 | C-term | □□□□...□□□■ |
| Immunization | MAP 8 - Crude 8-20 aa, at C-term. only | MAP 8 | C-term | □□□□...□□□■ |
| Immunization | OVA - | CO-OVA | C-term | □□□□...□□□■ |
| Cyclization/Dimerization/Special Synthesis | 3-Azido-Alanine - Aza | [Aza] | Internal | ■■■■...■■■■ |
| Cyclization/Dimerization/Special Synthesis | 5-Azidopentanoyl - 5-Azidovalerianoyl | 5-Azidopentanoyl-NH | N-term | ■□□□...□□□□ |
| Cyclization/Dimerization/Special Synthesis | 6-Azido-Norleucine - Nle(N3) | [Nle(N3)] | Internal | ■■■■...■■■■ |
| Cyclization/Dimerization/Special Synthesis | Azidohomoalanine - Aha/ Dab(N3) | [Aha] | Internal | ■■■■...■■■■ |
| Cyclization/Dimerization/Special Synthesis | Azido-Lysine - | [K(N3)] | Internal | ■■■■...■■■■ |
| Cyclization/Dimerization/Special Synthesis | Cyclisation (C-C), disulfide - | [C cyclo(S-S)] | Internal | ■■■■...■■■■ |
| Cyclization/Dimerization/Special Synthesis | Cyclisation (D-K), amide bond - | [ ] | Internal | ■■■■...■■■■ |
| Cyclization/Dimerization/Special Synthesis | Cyclisation (E-K), amide bond - | [ ] | Internal | ■■■■...■■■■ |
| Cyclization/Dimerization/Special Synthesis | Cyclisation (K-C-terminus) - side chain of K to C-terminus | [ ] | Internal | ■■■■...■■■■ |
| Cyclization/Dimerization/Special Synthesis | Cyclisation (NH-CO), homodetic - | [ ] | N-term | ■□□□...□□□■ |
| Cyclization/Dimerization/Special Synthesis | Double disulfide - | [C cyclo(S-S)] | Internal | ■■■■...■■■■ |
| Cyclization/Dimerization/Special Synthesis | D-Propargylglycine - D-Pra | [D-Pra] | Internal | ■■■■...■■■■ |
| Cyclization/Dimerization/Special Synthesis | Hetero-Dimer - | [ ] | Internal | ■■■■...■■■■ |
| Cyclization/Dimerization/Special Synthesis | Homo-Dimer - | [ ] | Internal | ■■■■...■■■■ |
| Cyclization/Dimerization/Special Synthesis | Mixed amino acids - | [X] | Internal | ■■■■...■■■■ |
| Cyclization/Dimerization/Special Synthesis | para-Azido-Phenylalanine - | [F(N3)] | Internal | ■■■■...■■■■ |
| Cyclization/Dimerization/Special Synthesis | Propargylalanine - alpha-Me-L-Ala(Pentynyl)-OH | [Propargylala] | Internal | ■■■■...■■■■ |
| Cyclization/Dimerization/Special Synthesis | Propargylglycine - Pra | [Pra] | Internal | ■■■■...■■■■ |
| Cyclization/Dimerization/Special Synthesis | Side chain coupling to Lys - Asymmetric Sequence | [K] | Internal | ■■■■...■■■■ |
| Cyclization/Dimerization/Special Synthesis | Side chain coupling to Lys - Symmetric Sequence | [K] | Internal | ■■■■...■■■■ |
| Cyclization/Dimerization/Special Synthesis | Site directed disulfide bridge - Cyclisation (C-C) | [Cys cyclo(S-S)] | Internal | ■■■■...■■■■ |
For Research Use Only. Not for use in diagnostic procedures.